About 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine
2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine (PubChem CID 141290959) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine.
Molecular Properties
| Compound Name | 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine |
| PubChem CID | 141290959 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine |
| SMILES | CCn1cnc(-c2cnccn2)n1 |
| InChI | InChI=1S/C8H9N5/c1-2-13-6-11-8(12-13)7-5-9-3-4-10-7/h3-6H,2H2,1H3 |
| InChIKey | XMWFZUPDRMMXLS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine?
The IUPAC name of 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine (CID 141290959) is 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine.
What is the SMILES notation for 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine?
The canonical SMILES for 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine is CCn1cnc(-c2cnccn2)n1.
What is the InChIKey of 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine?
The InChIKey is XMWFZUPDRMMXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c1-2-13-6-11-8(12-13)7-5-9-3-4-10-7/h3-6H,2H2,1H3.
What are the key properties of 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine?
2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine has a molecular weight of 175.19 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethyl-1,2,4-triazol-3-yl)pyrazine is sourced from PubChem (CID 141290959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).