About N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine
N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine (PubChem CID 141291069) has the molecular formula C21H30FN3
and a molecular weight of 343.49 g/mol. Its IUPAC name is N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine |
| PubChem CID | 141291069 |
| Molecular Formula | C21H30FN3 |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine |
| SMILES | CCNC1=CN=CC(Cc2ccc(C3CCN(CC)CC3)c(F)c2)C1 |
| InChI | InChI=1S/C21H30FN3/c1-3-24-19-12-17(14-23-15-19)11-16-5-6-20(21(22)13-16)18-7-9-25(4-2)10-8-18/h5-6,13-15,17-18,24H,3-4,7-12H2,1-2H3 |
| InChIKey | NJTOASWUOUHESM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine?
The IUPAC name of N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine (CID 141291069) is N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine.
What is the SMILES notation for N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine?
The canonical SMILES for N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine is CCNC1=CN=CC(Cc2ccc(C3CCN(CC)CC3)c(F)c2)C1.
What is the InChIKey of N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine?
The InChIKey is NJTOASWUOUHESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30FN3/c1-3-24-19-12-17(14-23-15-19)11-16-5-6-20(21(22)13-16)18-7-9-25(4-2)10-8-18/h5-6,13-15,17-18,24H,3-4,7-12H2,1-2H3.
What are the key properties of N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine?
N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine has a molecular weight of 343.49 g/mol, XLogP of 4.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-[[4-(1-ethylpiperidin-4-yl)-3-fluorophenyl]methyl]-3,4-dihydropyridin-5-amine is sourced from PubChem (CID 141291069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).