About 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine
4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine (PubChem CID 141291421) has the molecular formula C11H16F3N3
and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine |
| PubChem CID | 141291421 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine |
| SMILES | FC(F)(F)CCc1cnc(C2CCNCC2)[nH]1 |
| InChI | InChI=1S/C11H16F3N3/c12-11(13,14)4-1-9-7-16-10(17-9)8-2-5-15-6-3-8/h7-8,15H,1-6H2,(H,16,17) |
| InChIKey | OYDOSNZHWVBEMF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine?
The IUPAC name of 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine (CID 141291421) is 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine.
What is the SMILES notation for 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine?
The canonical SMILES for 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine is FC(F)(F)CCc1cnc(C2CCNCC2)[nH]1.
What is the InChIKey of 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine?
The InChIKey is OYDOSNZHWVBEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3/c12-11(13,14)4-1-9-7-16-10(17-9)8-2-5-15-6-3-8/h7-8,15H,1-6H2,(H,16,17).
What are the key properties of 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine?
4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine has a molecular weight of 247.26 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,3,3-trifluoropropyl)-1H-imidazol-2-yl]piperidine is sourced from PubChem (CID 141291421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).