About 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one
2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one (PubChem CID 141291746) has the molecular formula C19H20N4O
and a molecular weight of 320.40 g/mol. Its IUPAC name is 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one.
Molecular Properties
| Compound Name | 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one |
| PubChem CID | 141291746 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one |
| SMILES | Nc1ccc(C=C2CCC(=Cc3ccc(N)cc3N)C2=O)c(N)c1 |
| InChI | InChI=1S/C19H20N4O/c20-15-5-3-11(17(22)9-15)7-13-1-2-14(19(13)24)8-12-4-6-16(21)10-18(12)23/h3-10H,1-2,20-23H2 |
| InChIKey | XNPMZRHPMHKPGT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one?
The IUPAC name of 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one (CID 141291746) is 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one.
What is the SMILES notation for 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one?
The canonical SMILES for 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one is Nc1ccc(C=C2CCC(=Cc3ccc(N)cc3N)C2=O)c(N)c1.
What is the InChIKey of 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one?
The InChIKey is XNPMZRHPMHKPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O/c20-15-5-3-11(17(22)9-15)7-13-1-2-14(19(13)24)8-12-4-6-16(21)10-18(12)23/h3-10H,1-2,20-23H2.
What are the key properties of 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one?
2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one has a molecular weight of 320.40 g/mol, XLogP of 2.85, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[(2,4-diaminophenyl)methylidene]cyclopentan-1-one is sourced from PubChem (CID 141291746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).