C26H28F2O4 — CID 141291769
2-(3,4-difluorophenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol (PubChem CID 141291769) has the molecular formula C26H28F2O4 and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol.
| Compound Name | 2-(3,4-difluorophenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol |
|---|---|
| PubChem CID | 141291769 |
| Molecular Formula | C26H28F2O4 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4H-chromene-5,7-diol |
| SMILES | COC1=C(c2ccc(F)c(F)c2)Oc2c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c2C1 |
| InChI | InChI=1S/C26H28F2O4/c1-14(2)6-9-17-23(29)18(10-7-15(3)4)26-19(24(17)30)13-22(31-5)25(32-26)16-8-11-20(27)21(28)12-16/h6-8,11-12,29-30H,9-10,13H2,1-5H3 |
| InChIKey | UCPFHWMEKSVQFB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|