C22H19N5S2 — CID 141292300
5-[7-(1H-imidazol-5-yl)thianthren-2-yl]-2-pyrrolidin-2-yl-1H-imidazole (PubChem CID 141292300) has the molecular formula C22H19N5S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 5-[7-(1H-imidazol-5-yl)thianthren-2-yl]-2-pyrrolidin-2-yl-1H-imidazole.
| Compound Name | 5-[7-(1H-imidazol-5-yl)thianthren-2-yl]-2-pyrrolidin-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 141292300 |
| Molecular Formula | C22H19N5S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 5-[7-(1H-imidazol-5-yl)thianthren-2-yl]-2-pyrrolidin-2-yl-1H-imidazole |
| SMILES | c1ncc(-c2ccc3c(c2)Sc2ccc(-c4cnc(C5CCCN5)[nH]4)cc2S3)[nH]1 |
| InChI | InChI=1S/C22H19N5S2/c1-2-15(24-7-1)22-25-11-17(27-22)14-4-6-19-21(9-14)29-18-5-3-13(8-20(18)28-19)16-10-23-12-26-16/h3-6,8-12,15,24H,1-2,7H2,(H,23,26)(H,25,27) |
| InChIKey | LBBAJOGYEDPANG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |