About N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine
N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine (PubChem CID 141292582) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine.
Molecular Properties
| Compound Name | N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine |
| PubChem CID | 141292582 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine |
| SMILES | c1cc2c(NC3CCCCCC3)ccnn2c1 |
| InChI | InChI=1S/C14H19N3/c1-2-4-7-12(6-3-1)16-13-9-10-15-17-11-5-8-14(13)17/h5,8-12,16H,1-4,6-7H2 |
| InChIKey | FDALDQRMNZTTCK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine?
The IUPAC name of N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine (CID 141292582) is N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine.
What is the SMILES notation for N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine?
The canonical SMILES for N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine is c1cc2c(NC3CCCCCC3)ccnn2c1.
What is the InChIKey of N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine?
The InChIKey is FDALDQRMNZTTCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3/c1-2-4-7-12(6-3-1)16-13-9-10-15-17-11-5-8-14(13)17/h5,8-12,16H,1-4,6-7H2.
What are the key properties of N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine?
N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine has a molecular weight of 229.33 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptylpyrrolo[1,2-b]pyridazin-4-amine is sourced from PubChem (CID 141292582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).