About 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol
1-hydroxy-5-methylpyrimidine-2,4-dione;phenol (PubChem CID 141292603) has the molecular formula C11H12N2O4
and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol.
Molecular Properties
| Compound Name | 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol |
| PubChem CID | 141292603 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol |
| SMILES | Cc1cn(O)c(=O)[nH]c1=O.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C5H6N2O3/c7-6-4-2-1-3-5-6;1-3-2-7(10)5(9)6-4(3)8/h1-5,7H;2,10H,1H3,(H,6,8,9) |
| InChIKey | CIWDJADEKZLOIH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol?
The IUPAC name of 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol (CID 141292603) is 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol.
What is the SMILES notation for 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol?
The canonical SMILES for 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol is Cc1cn(O)c(=O)[nH]c1=O.Oc1ccccc1.
What is the InChIKey of 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol?
The InChIKey is CIWDJADEKZLOIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C5H6N2O3/c7-6-4-2-1-3-5-6;1-3-2-7(10)5(9)6-4(3)8/h1-5,7H;2,10H,1H3,(H,6,8,9).
What are the key properties of 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol?
1-hydroxy-5-methylpyrimidine-2,4-dione;phenol has a molecular weight of 236.23 g/mol, XLogP of 0.47, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-5-methylpyrimidine-2,4-dione;phenol is sourced from PubChem (CID 141292603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).