C14H15NO3 — CID 141293055
N-[(2R,3R)-1,3-dihydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide (PubChem CID 141293055) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[(2R,3R)-1,3-dihydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide.
| Compound Name | N-[(2R,3R)-1,3-dihydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 141293055 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | N-[(2R,3R)-1,3-dihydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
| SMILES | C[C@@H](O)[C@@H](CO)NC(=O)C1=C2C=C3CC3=C2C=C1 |
| InChI | InChI=1S/C14H15NO3/c1-7(17)13(6-16)15-14(18)10-3-2-9-11-4-8(11)5-12(9)10/h2-3,5,7,13,16-17H,4,6H2,1H3,(H,15,18)/t7-,13-/m1/s1 |
| InChIKey | ZUPHYPLBBNQAHY-FUXBKTLASA-N |
| XLogP | 0.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |