C14H12F3NO2 — CID 141293090
N-[(2R)-4,4,4-trifluoro-1-hydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide (PubChem CID 141293090) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is N-[(2R)-4,4,4-trifluoro-1-hydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide.
| Compound Name | N-[(2R)-4,4,4-trifluoro-1-hydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 141293090 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-[(2R)-4,4,4-trifluoro-1-hydroxybutan-2-yl]tricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
| SMILES | O=C(N[C@@H](CO)CC(F)(F)F)C1=C2C=C3CC3=C2C=C1 |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)5-8(6-19)18-13(20)10-2-1-9-11-3-7(11)4-12(9)10/h1-2,4,8,19H,3,5-6H2,(H,18,20)/t8-/m1/s1 |
| InChIKey | VCSFLJPCKXBMKM-MRVPVSSYSA-N |
| XLogP | 1.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |