C12H21NO2 — CID 141293223
N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-methylpenta-2,4-dienamide (PubChem CID 141293223) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-methylpenta-2,4-dienamide.
| Compound Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 141293223 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-methylpenta-2,4-dienamide |
| SMILES | C=CC=C(C)C(=O)N[C@H](CO)C(C)(C)C |
| InChI | InChI=1S/C12H21NO2/c1-6-7-9(2)11(15)13-10(8-14)12(3,4)5/h6-7,10,14H,1,8H2,2-5H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | JBFIEEGJFXULCH-SNVBAGLBSA-N |
| XLogP | 1.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|