About 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide
3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide (PubChem CID 141293296) has the molecular formula C8H12F2N4O
and a molecular weight of 218.21 g/mol. Its IUPAC name is 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide |
| PubChem CID | 141293296 |
| Molecular Formula | C8H12F2N4O |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1cc(N)nn1CC(F)F |
| InChI | InChI=1S/C8H12F2N4O/c1-13(2)8(15)5-3-7(11)12-14(5)4-6(9)10/h3,6H,4H2,1-2H3,(H2,11,12) |
| InChIKey | BZUPVOVOVCRCRZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide?
The IUPAC name of 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide (CID 141293296) is 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide.
What is the SMILES notation for 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide?
The canonical SMILES for 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide is CN(C)C(=O)c1cc(N)nn1CC(F)F.
What is the InChIKey of 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide?
The InChIKey is BZUPVOVOVCRCRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N4O/c1-13(2)8(15)5-3-7(11)12-14(5)4-6(9)10/h3,6H,4H2,1-2H3,(H2,11,12).
What are the key properties of 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide?
3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide has a molecular weight of 218.21 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2,2-difluoroethyl)-N,N-dimethylpyrazole-5-carboxamide is sourced from PubChem (CID 141293296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).