C15H19N3 — CID 141293424
(2Z)-7,11,18-triazatetracyclo[9.7.0.03,7.012,17]octadeca-1(18),2,14,16-tetraene (PubChem CID 141293424) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is (2Z)-7,11,18-triazatetracyclo[9.7.0.03,7.012,17]octadeca-1(18),2,14,16-tetraene.
| Compound Name | (2Z)-7,11,18-triazatetracyclo[9.7.0.03,7.012,17]octadeca-1(18),2,14,16-tetraene |
|---|---|
| PubChem CID | 141293424 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (2Z)-7,11,18-triazatetracyclo[9.7.0.03,7.012,17]octadeca-1(18),2,14,16-tetraene |
| SMILES | C1=CCC2C(=C1)N=C1/C=C3/CCCN3CCCN12 |
| InChI | InChI=1S/C15H19N3/c1-2-7-14-13(6-1)16-15-11-12-5-3-8-17(12)9-4-10-18(14)15/h1-2,6,11,14H,3-5,7-10H2/b12-11- |
| InChIKey | CSTDZGMDIMEZFJ-QXMHVHEDSA-N |
| XLogP | 2.30 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |