C11H9N3 — CID 141293433
4,7,10-triazatricyclo[8.4.0.03,7]tetradeca-1,3,5,8,11,13-hexaene (PubChem CID 141293433) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4,7,10-triazatricyclo[8.4.0.03,7]tetradeca-1,3,5,8,11,13-hexaene.
| Compound Name | 4,7,10-triazatricyclo[8.4.0.03,7]tetradeca-1,3,5,8,11,13-hexaene |
|---|---|
| PubChem CID | 141293433 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4,7,10-triazatricyclo[8.4.0.03,7]tetradeca-1,3,5,8,11,13-hexaene |
| SMILES | C1=CC2=Cc3nccn3C=CN2C=C1 |
| InChI | InChI=1S/C11H9N3/c1-2-5-13-7-8-14-6-4-12-11(14)9-10(13)3-1/h1-9H |
| InChIKey | KBTUXGFETPAOFB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |