C13H2F12 — CID 141293551
1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene (PubChem CID 141293551) has the molecular formula C13H2F12 and a molecular weight of 386.14 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 141293551 |
| Molecular Formula | C13H2F12 |
| Molecular Weight | 386.14 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene |
| SMILES | FC1=CC(F)=C(F)C(c2c(F)c(F)c(F)c(F)c2F)C1(F)C(F)(F)F |
| InChI | InChI=1S/C13H2F12/c14-2-1-3(15)12(22,13(23,24)25)5(6(2)16)4-7(17)9(19)11(21)10(20)8(4)18/h1,5H |
| InChIKey | SKOSAZYAIMOUHK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.14 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|