C30H51N3O4 — CID 141293787
2,4,6-tris[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]phenol (PubChem CID 141293787) has the molecular formula C30H51N3O4 and a molecular weight of 517.76 g/mol. Its IUPAC name is 2,4,6-tris[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]phenol.
| Compound Name | 2,4,6-tris[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 141293787 |
| Molecular Formula | C30H51N3O4 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.39 |
| IUPAC Name | 2,4,6-tris[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]phenol |
| SMILES | CC(O)C1CCCCN1Cc1cc(CN2CCCCC2C(C)O)c(O)c(CN2CCCCC2C(C)O)c1 |
| InChI | InChI=1S/C30H51N3O4/c1-21(34)27-10-4-7-13-31(27)18-24-16-25(19-32-14-8-5-11-28(32)22(2)35)30(37)26(17-24)20-33-15-9-6-12-29(33)23(3)36/h16-17,21-23,27-29,34-37H,4-15,18-20H2,1-3H3 |
| InChIKey | JZPDZHSKWFFDHS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|