About methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate
methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate (PubChem CID 141294552) has the molecular formula C23H16N2O2
and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate |
| PubChem CID | 141294552 |
| Molecular Formula | C23H16N2O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate |
| SMILES | COC(=O)n1nc(-c2ccccc2)c2c3cc4ccccc4cc3ccc21 |
| InChI | InChI=1S/C23H16N2O2/c1-27-23(26)25-20-12-11-18-13-16-9-5-6-10-17(16)14-19(18)21(20)22(24-25)15-7-3-2-4-8-15/h2-14H,1H3 |
| InChIKey | MDFAAAKTQOUVDI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate?
The IUPAC name of methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate (CID 141294552) is methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate.
What is the SMILES notation for methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate?
The canonical SMILES for methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate is COC(=O)n1nc(-c2ccccc2)c2c3cc4ccccc4cc3ccc21.
What is the InChIKey of methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate?
The InChIKey is MDFAAAKTQOUVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O2/c1-27-23(26)25-20-12-11-18-13-16-9-5-6-10-17(16)14-19(18)21(20)22(24-25)15-7-3-2-4-8-15/h2-14H,1H3.
What are the key properties of methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate?
methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate has a molecular weight of 352.39 g/mol, XLogP of 5.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-phenylnaphtho[2,3-e]indazole-3-carboxylate is sourced from PubChem (CID 141294552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).