C9H13N5O3S — CID 141294822
N-(2-methoxyethyl)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 141294822) has the molecular formula C9H13N5O3S and a molecular weight of 271.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N-(2-methoxyethyl)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 141294822 |
| Molecular Formula | C9H13N5O3S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N-(2-methoxyethyl)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | COCCNc1nc(S(C)(=O)=O)nc2ccnn12 |
| InChI | InChI=1S/C9H13N5O3S/c1-17-6-5-10-8-13-9(18(2,15)16)12-7-3-4-11-14(7)8/h3-4H,5-6H2,1-2H3,(H,10,12,13) |
| InChIKey | VJBNNEPFQQYBHH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|