C13H11FN2O4 — CID 141295047
methyl 2-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 141295047) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | methyl 2-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 141295047 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)methyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(Cc2ccc(F)cc2)[nH]c(=O)c1O |
| InChI | InChI=1S/C13H11FN2O4/c1-20-13(19)10-11(17)12(18)16-9(15-10)6-7-2-4-8(14)5-3-7/h2-5,17H,6H2,1H3,(H,15,16,18) |
| InChIKey | SWHYEQGFESDLGJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |