C21H19NO2 — CID 141295945
5-[4-(4-cyclopropylphenyl)phenyl]-3-methyl-4-(oxiran-2-yl)-1,2-oxazole (PubChem CID 141295945) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-[4-(4-cyclopropylphenyl)phenyl]-3-methyl-4-(oxiran-2-yl)-1,2-oxazole.
| Compound Name | 5-[4-(4-cyclopropylphenyl)phenyl]-3-methyl-4-(oxiran-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 141295945 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-[4-(4-cyclopropylphenyl)phenyl]-3-methyl-4-(oxiran-2-yl)-1,2-oxazole |
| SMILES | Cc1noc(-c2ccc(-c3ccc(C4CC4)cc3)cc2)c1C1CO1 |
| InChI | InChI=1S/C21H19NO2/c1-13-20(19-12-23-19)21(24-22-13)18-10-8-17(9-11-18)16-6-4-15(5-7-16)14-2-3-14/h4-11,14,19H,2-3,12H2,1H3 |
| InChIKey | JXZSSZSGVRPJIK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|