C17H22N2O2S — CID 141296393
N-[4-tert-butyl-6-(4-methoxyphenyl)-2H-1,3-thiazin-2-yl]acetamide (PubChem CID 141296393) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-[4-tert-butyl-6-(4-methoxyphenyl)-2H-1,3-thiazin-2-yl]acetamide.
| Compound Name | N-[4-tert-butyl-6-(4-methoxyphenyl)-2H-1,3-thiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 141296393 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[4-tert-butyl-6-(4-methoxyphenyl)-2H-1,3-thiazin-2-yl]acetamide |
| SMILES | COc1ccc(C2=CC(C(C)(C)C)=NC(NC(C)=O)S2)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-11(20)18-16-19-15(17(2,3)4)10-14(22-16)12-6-8-13(21-5)9-7-12/h6-10,16H,1-5H3,(H,18,20) |
| InChIKey | UBCQBCWCSSPKEF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |