About ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate
ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate (PubChem CID 141296475) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 141296475 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(O)C=CC1 |
| InChI | InChI=1S/C9H12O3/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3,5-6,8,10H,2,4H2,1H3 |
| InChIKey | BHDVDTUDXPYYGG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate (CID 141296475) is ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate is CCOC(=O)C1=CC(O)C=CC1.
What is the InChIKey of ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate?
The InChIKey is BHDVDTUDXPYYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3,5-6,8,10H,2,4H2,1H3.
What are the key properties of ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate?
ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate has a molecular weight of 168.19 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxycyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 141296475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).