C13H26FNO — CID 141296696
2-fluoro-N-(2,4,4-trimethylpentan-2-yl)pentanamide (PubChem CID 141296696) has the molecular formula C13H26FNO and a molecular weight of 231.35 g/mol. Its IUPAC name is 2-fluoro-N-(2,4,4-trimethylpentan-2-yl)pentanamide.
| Compound Name | 2-fluoro-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
|---|---|
| PubChem CID | 141296696 |
| Molecular Formula | C13H26FNO |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2-fluoro-N-(2,4,4-trimethylpentan-2-yl)pentanamide |
| SMILES | CCCC(F)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C13H26FNO/c1-7-8-10(14)11(16)15-13(5,6)9-12(2,3)4/h10H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | UDGFNFGRTJZSBE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |