C20H24N2O3S — CID 141296715
[5-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-1H-pyrrol-2-yl]methyl methanesulfonate (PubChem CID 141296715) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is [5-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-1H-pyrrol-2-yl]methyl methanesulfonate.
| Compound Name | [5-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-1H-pyrrol-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 141296715 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [5-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-1H-pyrrol-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccc(CN2CCC3(C=Cc4ccccc43)CC2)[nH]1 |
| InChI | InChI=1S/C20H24N2O3S/c1-26(23,24)25-15-18-7-6-17(21-18)14-22-12-10-20(11-13-22)9-8-16-4-2-3-5-19(16)20/h2-9,21H,10-15H2,1H3 |
| InChIKey | NHBJYRYDEKJRHL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|