C7H14FNO2 — CID 141296803
(3R,4R,5R)-5-[(1R)-1-fluoroethyl]piperidine-3,4-diol (PubChem CID 141296803) has the molecular formula C7H14FNO2 and a molecular weight of 163.19 g/mol. Its IUPAC name is (3R,4R,5R)-5-[(1R)-1-fluoroethyl]piperidine-3,4-diol.
| Compound Name | (3R,4R,5R)-5-[(1R)-1-fluoroethyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 141296803 |
| Molecular Formula | C7H14FNO2 |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (3R,4R,5R)-5-[(1R)-1-fluoroethyl]piperidine-3,4-diol |
| SMILES | C[C@@H](F)[C@@H]1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14FNO2/c1-4(8)5-2-9-3-6(10)7(5)11/h4-7,9-11H,2-3H2,1H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | ADGVYUWMIQUOME-XZBKPIIZSA-N |
| XLogP | -0.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |