About 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole
6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole (PubChem CID 141297006) has the molecular formula C11H13Cl2N
and a molecular weight of 230.14 g/mol. Its IUPAC name is 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole |
| PubChem CID | 141297006 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole |
| SMILES | ClCCCc1cc2c(cc1Cl)NCC2 |
| InChI | InChI=1S/C11H13Cl2N/c12-4-1-2-8-6-9-3-5-14-11(9)7-10(8)13/h6-7,14H,1-5H2 |
| InChIKey | BXTPRVDRYRDWCW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole?
The IUPAC name of 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole (CID 141297006) is 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole?
The canonical SMILES for 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole is ClCCCc1cc2c(cc1Cl)NCC2.
What is the InChIKey of 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole?
The InChIKey is BXTPRVDRYRDWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2N/c12-4-1-2-8-6-9-3-5-14-11(9)7-10(8)13/h6-7,14H,1-5H2.
What are the key properties of 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole?
6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole has a molecular weight of 230.14 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-(3-chloropropyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 141297006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).