About (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol
(S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol (PubChem CID 141297246) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol.
Molecular Properties
| Compound Name | (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol |
| PubChem CID | 141297246 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol |
| SMILES | Cc1nocc1[C@H](O)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C14H14N4O2/c1-10-12(9-20-16-10)14(19)13-8-18(17-15-13)7-11-5-3-2-4-6-11/h2-6,8-9,14,19H,7H2,1H3/t14-/m0/s1 |
| InChIKey | LOZCMNAPUVVPOM-AWEZNQCLSA-N |
| XLogP | 1.70 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol?
The IUPAC name of (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol (CID 141297246) is (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol.
What is the SMILES notation for (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol?
The canonical SMILES for (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol is Cc1nocc1[C@H](O)c1cn(Cc2ccccc2)nn1.
What is the InChIKey of (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol?
The InChIKey is LOZCMNAPUVVPOM-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-10-12(9-20-16-10)14(19)13-8-18(17-15-13)7-11-5-3-2-4-6-11/h2-6,8-9,14,19H,7H2,1H3/t14-/m0/s1.
What are the key properties of (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol?
(S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol has a molecular weight of 270.29 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(1-benzyltriazol-4-yl)-(3-methyl-1,2-oxazol-4-yl)methanol is sourced from PubChem (CID 141297246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).