C19H21N5 — CID 141298121
2-[[4-(4-phenylimidazol-1-yl)piperidin-1-yl]methyl]pyrimidine (PubChem CID 141298121) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-[[4-(4-phenylimidazol-1-yl)piperidin-1-yl]methyl]pyrimidine.
| Compound Name | 2-[[4-(4-phenylimidazol-1-yl)piperidin-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 141298121 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-[[4-(4-phenylimidazol-1-yl)piperidin-1-yl]methyl]pyrimidine |
| SMILES | c1ccc(-c2cn(C3CCN(Cc4ncccn4)CC3)cn2)cc1 |
| InChI | InChI=1S/C19H21N5/c1-2-5-16(6-3-1)18-13-24(15-22-18)17-7-11-23(12-8-17)14-19-20-9-4-10-21-19/h1-6,9-10,13,15,17H,7-8,11-12,14H2 |
| InChIKey | OGIKRHDQPJEMIS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |