About 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione
4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione (PubChem CID 141298220) has the molecular formula C11H18O4Si
and a molecular weight of 242.35 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione.
Molecular Properties
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione |
| PubChem CID | 141298220 |
| Molecular Formula | C11H18O4Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione |
| SMILES | CC(C)(C)[Si](C)(C)C1CC(=O)OC(=O)C1=O |
| InChI | InChI=1S/C11H18O4Si/c1-11(2,3)16(4,5)7-6-8(12)15-10(14)9(7)13/h7H,6H2,1-5H3 |
| InChIKey | KHUHCJVVNQRIFD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione?
The IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione (CID 141298220) is 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione.
What is the SMILES notation for 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione?
The canonical SMILES for 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione is CC(C)(C)[Si](C)(C)C1CC(=O)OC(=O)C1=O.
What is the InChIKey of 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione?
The InChIKey is KHUHCJVVNQRIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4Si/c1-11(2,3)16(4,5)7-6-8(12)15-10(14)9(7)13/h7H,6H2,1-5H3.
What are the key properties of 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione?
4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione has a molecular weight of 242.35 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(dimethyl)silyl]oxane-2,3,6-trione is sourced from PubChem (CID 141298220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).