C24H42N2O — CID 14129826
(2E,6E,10E)-N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide (PubChem CID 14129826) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is (2E,6E,10E)-N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide.
| Compound Name | (2E,6E,10E)-N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 14129826 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | (2E,6E,10E)-N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)NCCN(C)C |
| InChI | InChI=1S/C24H42N2O/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-16-23(5)19-24(27)25-17-18-26(6)7/h11,13,15,19H,8-10,12,14,16-18H2,1-7H3,(H,25,27)/b21-13+,22-15+,23-19+ |
| InChIKey | JHIGCWITCKAWCF-TWMIAMRASA-N |
| XLogP | 5.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|