C26H43NO2 — CID 14129831
(2E,6E,10E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one (PubChem CID 14129831) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is (2E,6E,10E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one.
| Compound Name | (2E,6E,10E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
|---|---|
| PubChem CID | 14129831 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | (2E,6E,10E)-1-[2-(hydroxymethyl)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)N1CCCCC1CO |
| InChI | InChI=1S/C26H43NO2/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)19-26(29)27-18-7-6-17-25(27)20-28/h11,13,15,19,25,28H,6-10,12,14,16-18,20H2,1-5H3/b22-13+,23-15+,24-19+ |
| InChIKey | GCVLMTASARZXFY-HWIYRCFISA-N |
| XLogP | 6.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|