C26H46N2O — CID 14129842
(2E,6E,10E)-N-[2-(diethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide (PubChem CID 14129842) has the molecular formula C26H46N2O and a molecular weight of 402.67 g/mol. Its IUPAC name is (2E,6E,10E)-N-[2-(diethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide.
| Compound Name | (2E,6E,10E)-N-[2-(diethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 14129842 |
| Molecular Formula | C26H46N2O |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.36 |
| IUPAC Name | (2E,6E,10E)-N-[2-(diethylamino)ethyl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
| SMILES | CCN(CC)CCNC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H46N2O/c1-8-28(9-2)20-19-27-26(29)21-25(7)18-12-17-24(6)16-11-15-23(5)14-10-13-22(3)4/h13,15,17,21H,8-12,14,16,18-20H2,1-7H3,(H,27,29)/b23-15+,24-17+,25-21+ |
| InChIKey | BOYJXQBVOYBPST-UPCFISKHSA-N |
| XLogP | 6.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|