C23H34N2O — CID 14129844
(2E,6E,10E)-1-imidazol-1-yl-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one (PubChem CID 14129844) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is (2E,6E,10E)-1-imidazol-1-yl-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one.
| Compound Name | (2E,6E,10E)-1-imidazol-1-yl-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
|---|---|
| PubChem CID | 14129844 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | (2E,6E,10E)-1-imidazol-1-yl-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)n1ccnc1 |
| InChI | InChI=1S/C23H34N2O/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(5)17-23(26)25-16-15-24-18-25/h9,11,13,15-18H,6-8,10,12,14H2,1-5H3/b20-11+,21-13+,22-17+ |
| InChIKey | GUQGYEBJQFKNLL-MJBFCUISSA-N |
| XLogP | 6.67 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|