C24H44N2 — CID 14129850
N',N'-dimethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine (PubChem CID 14129850) has the molecular formula C24H44N2 and a molecular weight of 360.63 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 14129850 |
| Molecular Formula | C24H44N2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.35 |
| IUPAC Name | N',N'-dimethyl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]ethane-1,2-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CNCCN(C)C |
| InChI | InChI=1S/C24H44N2/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)17-18-25-19-20-26(6)7/h11,13,15,17,25H,8-10,12,14,16,18-20H2,1-7H3/b22-13+,23-15+,24-17+ |
| InChIKey | XHCKGZHONFXTLK-IYRYOAFKSA-N |
| XLogP | 6.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|