C10H10Cl4S4 — CID 141299095
[2,3,4,5-tetrachloro-6-(sulfanylmethylsulfanylmethyl)phenyl]methylsulfanylmethanethiol (PubChem CID 141299095) has the molecular formula C10H10Cl4S4 and a molecular weight of 400.27 g/mol. Its IUPAC name is [2,3,4,5-tetrachloro-6-(sulfanylmethylsulfanylmethyl)phenyl]methylsulfanylmethanethiol.
| Compound Name | [2,3,4,5-tetrachloro-6-(sulfanylmethylsulfanylmethyl)phenyl]methylsulfanylmethanethiol |
|---|---|
| PubChem CID | 141299095 |
| Molecular Formula | C10H10Cl4S4 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 397.84 |
| IUPAC Name | [2,3,4,5-tetrachloro-6-(sulfanylmethylsulfanylmethyl)phenyl]methylsulfanylmethanethiol |
| SMILES | SCSCc1c(Cl)c(Cl)c(Cl)c(Cl)c1CSCS |
| InChI | InChI=1S/C10H10Cl4S4/c11-7-5(1-17-3-15)6(2-18-4-16)8(12)10(14)9(7)13/h15-16H,1-4H2 |
| InChIKey | NDTYRNSZDVPQKL-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|