About 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole
1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole (PubChem CID 141299247) has the molecular formula C4H8N6O
and a molecular weight of 156.15 g/mol. Its IUPAC name is 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole.
Molecular Properties
| Compound Name | 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole |
| PubChem CID | 141299247 |
| Molecular Formula | C4H8N6O |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole |
| SMILES | C1CN(ON2CCN=N2)N=N1 |
| InChI | InChI=1S/C4H8N6O/c1-3-9(7-5-1)11-10-4-2-6-8-10/h1-4H2 |
| InChIKey | BOSXYCVKIUCOLJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 65.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole?
The IUPAC name of 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole (CID 141299247) is 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole.
What is the SMILES notation for 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole?
The canonical SMILES for 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole is C1CN(ON2CCN=N2)N=N1.
What is the InChIKey of 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole?
The InChIKey is BOSXYCVKIUCOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N6O/c1-3-9(7-5-1)11-10-4-2-6-8-10/h1-4H2.
What are the key properties of 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole?
1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole has a molecular weight of 156.15 g/mol, XLogP of 0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydrotriazol-1-yloxy)-4,5-dihydrotriazole is sourced from PubChem (CID 141299247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).