C11H15F3N2O — CID 141299350
1-methyl-2-[2,2,2-trifluoro-1-(prop-2-enylamino)ethyl]-2H-pyridin-3-ol (PubChem CID 141299350) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-methyl-2-[2,2,2-trifluoro-1-(prop-2-enylamino)ethyl]-2H-pyridin-3-ol.
| Compound Name | 1-methyl-2-[2,2,2-trifluoro-1-(prop-2-enylamino)ethyl]-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 141299350 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-methyl-2-[2,2,2-trifluoro-1-(prop-2-enylamino)ethyl]-2H-pyridin-3-ol |
| SMILES | C=CCNC(C1C(O)=CC=CN1C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O/c1-3-6-15-10(11(12,13)14)9-8(17)5-4-7-16(9)2/h3-5,7,9-10,15,17H,1,6H2,2H3 |
| InChIKey | CUTZAFUNHODNAD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|