C9H11ClF3NO — CID 141299354
5-(1-chloro-2,2,2-trifluoroethyl)-1,2-dimethyl-2H-pyridin-3-ol (PubChem CID 141299354) has the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. Its IUPAC name is 5-(1-chloro-2,2,2-trifluoroethyl)-1,2-dimethyl-2H-pyridin-3-ol.
| Compound Name | 5-(1-chloro-2,2,2-trifluoroethyl)-1,2-dimethyl-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 141299354 |
| Molecular Formula | C9H11ClF3NO |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 5-(1-chloro-2,2,2-trifluoroethyl)-1,2-dimethyl-2H-pyridin-3-ol |
| SMILES | CC1C(O)=CC(C(Cl)C(F)(F)F)=CN1C |
| InChI | InChI=1S/C9H11ClF3NO/c1-5-7(15)3-6(4-14(5)2)8(10)9(11,12)13/h3-5,8,15H,1-2H3 |
| InChIKey | LMCCUSJUZBYGCW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|