About 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine
3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine (PubChem CID 141299458) has the molecular formula C5H9F2N3
and a molecular weight of 149.14 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine.
Analyze 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine?
The IUPAC name of 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine (CID 141299458) is 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine.
What is the SMILES notation for 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine?
The canonical SMILES for 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine is NC1=NC(C(F)F)CNC1.
What is the InChIKey of 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine?
The InChIKey is OSOZZVHRYTWVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2N3/c6-5(7)3-1-9-2-4(8)10-3/h3,5,9H,1-2H2,(H2,8,10).
What are the key properties of 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine?
3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine has a molecular weight of 149.14 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-1,2,3,6-tetrahydropyrazin-5-amine is sourced from PubChem (CID 141299458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).