About 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one
6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one (PubChem CID 141299460) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one.
Molecular Properties
| Compound Name | 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one |
| PubChem CID | 141299460 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one |
| SMILES | CC1CN(C)C(=O)C(N)=N1 |
| InChI | InChI=1S/C6H11N3O/c1-4-3-9(2)6(10)5(7)8-4/h4H,3H2,1-2H3,(H2,7,8) |
| InChIKey | MDANKDKPUYLYMK-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one?
The IUPAC name of 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one (CID 141299460) is 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one.
What is the SMILES notation for 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one?
The canonical SMILES for 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one is CC1CN(C)C(=O)C(N)=N1.
What is the InChIKey of 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one?
The InChIKey is MDANKDKPUYLYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-4-3-9(2)6(10)5(7)8-4/h4H,3H2,1-2H3,(H2,7,8).
What are the key properties of 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one?
6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one has a molecular weight of 141.17 g/mol, XLogP of -0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,4-dimethyl-2,3-dihydropyrazin-5-one is sourced from PubChem (CID 141299460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).