C19H26N6O2 — CID 141300717
ethyl 2-[4-[6-(4-aminoanilino)-2-methylpyrimidin-4-yl]piperazin-1-yl]acetate (PubChem CID 141300717) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is ethyl 2-[4-[6-(4-aminoanilino)-2-methylpyrimidin-4-yl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[6-(4-aminoanilino)-2-methylpyrimidin-4-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 141300717 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | ethyl 2-[4-[6-(4-aminoanilino)-2-methylpyrimidin-4-yl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(c2cc(Nc3ccc(N)cc3)nc(C)n2)CC1 |
| InChI | InChI=1S/C19H26N6O2/c1-3-27-19(26)13-24-8-10-25(11-9-24)18-12-17(21-14(2)22-18)23-16-6-4-15(20)5-7-16/h4-7,12H,3,8-11,13,20H2,1-2H3,(H,21,22,23) |
| InChIKey | OEKPDANBCTYDEQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|