About 6-fluorocyclohexa-2,4-dien-1-imine
6-fluorocyclohexa-2,4-dien-1-imine (PubChem CID 141300863) has the molecular formula C6H6FN
and a molecular weight of 111.12 g/mol. Its IUPAC name is 6-fluorocyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 6-fluorocyclohexa-2,4-dien-1-imine |
| PubChem CID | 141300863 |
| Molecular Formula | C6H6FN |
| Molecular Weight | 111.12 g/mol |
| Exact Mass | 111.05 |
| IUPAC Name | 6-fluorocyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC1F |
| InChI | InChI=1S/C6H6FN/c7-5-3-1-2-4-6(5)8/h1-5,8H/b8-6+ |
| InChIKey | WVOSTUJTROCDKP-SOFGYWHQSA-N |
| XLogP | 1.47 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluorocyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorocyclohexa-2,4-dien-1-imine?
The IUPAC name of 6-fluorocyclohexa-2,4-dien-1-imine (CID 141300863) is 6-fluorocyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 6-fluorocyclohexa-2,4-dien-1-imine?
The canonical SMILES for 6-fluorocyclohexa-2,4-dien-1-imine is [H]/N=C1\C=CC=CC1F.
What is the InChIKey of 6-fluorocyclohexa-2,4-dien-1-imine?
The InChIKey is WVOSTUJTROCDKP-SOFGYWHQSA-N. The full InChI is InChI=1S/C6H6FN/c7-5-3-1-2-4-6(5)8/h1-5,8H/b8-6+.
What are the key properties of 6-fluorocyclohexa-2,4-dien-1-imine?
6-fluorocyclohexa-2,4-dien-1-imine has a molecular weight of 111.12 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorocyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 141300863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).