About 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine
3-methoxy-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 141301287) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 141301287 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | COc1n[nH]c2ncncc12 |
| InChI | InChI=1S/C6H6N4O/c1-11-6-4-2-7-3-8-5(4)9-10-6/h2-3H,1H3,(H,7,8,9,10) |
| InChIKey | VTFUHNSNSBJORG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine (CID 141301287) is 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine is COc1n[nH]c2ncncc12.
What is the InChIKey of 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is VTFUHNSNSBJORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c1-11-6-4-2-7-3-8-5(4)9-10-6/h2-3H,1H3,(H,7,8,9,10).
What are the key properties of 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine?
3-methoxy-1H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 150.14 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 141301287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).