C20H18N4O — CID 141301379
4-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,6-dimethylphenol (PubChem CID 141301379) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,6-dimethylphenol.
| Compound Name | 4-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 141301379 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-(2-anilino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,6-dimethylphenol |
| SMILES | Cc1cc(-c2ccc3nc(Nc4ccccc4)nn3c2)cc(C)c1O |
| InChI | InChI=1S/C20H18N4O/c1-13-10-16(11-14(2)19(13)25)15-8-9-18-22-20(23-24(18)12-15)21-17-6-4-3-5-7-17/h3-12,25H,1-2H3,(H,21,23) |
| InChIKey | GQKNWORYRRRTGW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |