About 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile
2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile (PubChem CID 141301418) has the molecular formula C19H32N4
and a molecular weight of 316.49 g/mol. Its IUPAC name is 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile.
Molecular Properties
| Compound Name | 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile |
| PubChem CID | 141301418 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile |
| SMILES | CC1CC(C(C#N)(C#N)C2CC(C)C(N)C(C)C2)CC(C)C1N |
| InChI | InChI=1S/C19H32N4/c1-11-5-15(6-12(2)17(11)22)19(9-20,10-21)16-7-13(3)18(23)14(4)8-16/h11-18H,5-8,22-23H2,1-4H3 |
| InChIKey | FEIUHCHGJNHGQU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile?
The IUPAC name of 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile (CID 141301418) is 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile.
What is the SMILES notation for 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile?
The canonical SMILES for 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile is CC1CC(C(C#N)(C#N)C2CC(C)C(N)C(C)C2)CC(C)C1N.
What is the InChIKey of 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile?
The InChIKey is FEIUHCHGJNHGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N4/c1-11-5-15(6-12(2)17(11)22)19(9-20,10-21)16-7-13(3)18(23)14(4)8-16/h11-18H,5-8,22-23H2,1-4H3.
What are the key properties of 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile?
2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile has a molecular weight of 316.49 g/mol, XLogP of 3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(4-amino-3,5-dimethylcyclohexyl)propanedinitrile is sourced from PubChem (CID 141301418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).