C14H19F3N2O5 — CID 141301654
1-cyano-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 141301654) has the molecular formula C14H19F3N2O5 and a molecular weight of 352.31 g/mol. Its IUPAC name is 1-cyano-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 1-cyano-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 141301654 |
| Molecular Formula | C14H19F3N2O5 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-cyano-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | N#CN1C(CC2CCOCC2)CCC1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H18N2O3.C2HF3O2/c13-8-14-10(1-2-11(14)12(15)16)7-9-3-5-17-6-4-9;3-2(4,5)1(6)7/h9-11H,1-7H2,(H,15,16);(H,6,7) |
| InChIKey | VLODRICGDXBBIL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|