About N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide
N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide (PubChem CID 141301701) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide |
| PubChem CID | 141301701 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide |
| SMILES | CN1CCCC1C(=O)NCC[C@H](O)CO |
| InChI | InChI=1S/C10H20N2O3/c1-12-6-2-3-9(12)10(15)11-5-4-8(14)7-13/h8-9,13-14H,2-7H2,1H3,(H,11,15)/t8-,9?/m0/s1 |
| InChIKey | BJXCUBZJODTDLK-IENPIDJESA-N |
| XLogP | -1.06 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide?
The IUPAC name of N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide (CID 141301701) is N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide.
What is the SMILES notation for N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide?
The canonical SMILES for N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide is CN1CCCC1C(=O)NCC[C@H](O)CO.
What is the InChIKey of N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide?
The InChIKey is BJXCUBZJODTDLK-IENPIDJESA-N. The full InChI is InChI=1S/C10H20N2O3/c1-12-6-2-3-9(12)10(15)11-5-4-8(14)7-13/h8-9,13-14H,2-7H2,1H3,(H,11,15)/t8-,9?/m0/s1.
What are the key properties of N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide?
N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide has a molecular weight of 216.28 g/mol, XLogP of -1.06, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3,4-dihydroxybutyl]-1-methylpyrrolidine-2-carboxamide is sourced from PubChem (CID 141301701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).