About [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid
[(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid (PubChem CID 141301778) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid |
| PubChem CID | 141301778 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid |
| SMILES | C=CC[C@H](NC(=O)O)c1cc(-c2ccc(N)cc2N)ccn1 |
| InChI | InChI=1S/C16H18N4O2/c1-2-3-14(20-16(21)22)15-8-10(6-7-19-15)12-5-4-11(17)9-13(12)18/h2,4-9,14,20H,1,3,17-18H2,(H,21,22)/t14-/m0/s1 |
| InChIKey | VLBVWESBJMTSOK-AWEZNQCLSA-N |
| XLogP | 2.80 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid?
The IUPAC name of [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid (CID 141301778) is [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid.
What is the SMILES notation for [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid?
The canonical SMILES for [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid is C=CC[C@H](NC(=O)O)c1cc(-c2ccc(N)cc2N)ccn1.
What is the InChIKey of [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid?
The InChIKey is VLBVWESBJMTSOK-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H18N4O2/c1-2-3-14(20-16(21)22)15-8-10(6-7-19-15)12-5-4-11(17)9-13(12)18/h2,4-9,14,20H,1,3,17-18H2,(H,21,22)/t14-/m0/s1.
What are the key properties of [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid?
[(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid has a molecular weight of 298.35 g/mol, XLogP of 2.80, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[4-(2,4-diaminophenyl)-2-pyridinyl]but-3-enyl]carbamic acid is sourced from PubChem (CID 141301778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).