C10H9N3O4 — CID 141301816
5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide (PubChem CID 141301816) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 141301816 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCc1onc(C(N)=O)c1-c1cc(C=O)no1 |
| InChI | InChI=1S/C10H9N3O4/c1-2-6-8(9(10(11)15)13-16-6)7-3-5(4-14)12-17-7/h3-4H,2H2,1H3,(H2,11,15) |
| InChIKey | VBTRJJCPNULKLP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|