About 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide
5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide (PubChem CID 141301816) has the molecular formula C10H9N3O4
and a molecular weight of 235.20 g/mol. Its IUPAC name is 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 141301816 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCc1onc(C(N)=O)c1-c1cc(C=O)no1 |
| InChI | InChI=1S/C10H9N3O4/c1-2-6-8(9(10(11)15)13-16-6)7-3-5(4-14)12-17-7/h3-4H,2H2,1H3,(H2,11,15) |
| InChIKey | VBTRJJCPNULKLP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide (CID 141301816) is 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide is CCc1onc(C(N)=O)c1-c1cc(C=O)no1.
What is the InChIKey of 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide?
The InChIKey is VBTRJJCPNULKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4/c1-2-6-8(9(10(11)15)13-16-6)7-3-5(4-14)12-17-7/h3-4H,2H2,1H3,(H2,11,15).
What are the key properties of 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide?
5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide has a molecular weight of 235.20 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-(3-formyl-1,2-oxazol-5-yl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 141301816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).