C26H24N4O2 — CID 141302239
2,3,5,6-tetrapyridin-2-ylcyclohexane-1,4-diol (PubChem CID 141302239) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2,3,5,6-tetrapyridin-2-ylcyclohexane-1,4-diol.
| Compound Name | 2,3,5,6-tetrapyridin-2-ylcyclohexane-1,4-diol |
|---|---|
| PubChem CID | 141302239 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2,3,5,6-tetrapyridin-2-ylcyclohexane-1,4-diol |
| SMILES | OC1C(c2ccccn2)C(c2ccccn2)C(O)C(c2ccccn2)C1c1ccccn1 |
| InChI | InChI=1S/C26H24N4O2/c31-25-21(17-9-1-5-13-27-17)22(18-10-2-6-14-28-18)26(32)24(20-12-4-8-16-30-20)23(25)19-11-3-7-15-29-19/h1-16,21-26,31-32H |
| InChIKey | POBZLPYENHWDNU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |